C26H36N2O10S2 — CID 87734821
(2-octylsulfonyloxy-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-6-yl) octane-1-sulfonate (PubChem CID 87734821) has the molecular formula C26H36N2O10S2 and a molecular weight of 600.71 g/mol. Its IUPAC name is (2-octylsulfonyloxy-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-6-yl) octane-1-sulfonate.
| Compound Name | (2-octylsulfonyloxy-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-6-yl) octane-1-sulfonate |
|---|---|
| PubChem CID | 87734821 |
| Molecular Formula | C26H36N2O10S2 |
| Molecular Weight | 600.71 g/mol |
| Exact Mass | 600.18 |
| IUPAC Name | (2-octylsulfonyloxy-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-6-yl) octane-1-sulfonate |
| SMILES | CCCCCCCCS(=O)(=O)On1c(=O)c2cc3c(=O)n(OS(=O)(=O)CCCCCCCC)c(=O)c3cc2c1=O |
| InChI | InChI=1S/C26H36N2O10S2/c1-3-5-7-9-11-13-15-39(33,34)37-27-23(29)19-17-21-22(18-20(19)24(27)30)26(32)28(25(21)31)38-40(35,36)16-14-12-10-8-6-4-2/h17-18H,3-16H2,1-2H3 |
| InChIKey | MUIPMGNJAMPMAU-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 164.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.71 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|