About [2-[(E)-2-(3,5-dichloro-4-hexoxyphenyl)ethenyl]-4-methyl-6-oxo-1-pyridinyl] propane-1-sulfonate
[2-[(E)-2-(3,5-dichloro-4-hexoxyphenyl)ethenyl]-4-methyl-6-oxo-1-pyridinyl] propane-1-sulfonate (PubChem CID 19100003) has the molecular formula C23H29Cl2NO5S
and a molecular weight of 502.46 g/mol. Its IUPAC name is [2-[(E)-2-(3,5-dichloro-4-hexoxyphenyl)ethenyl]-4-methyl-6-oxo-1-pyridinyl] propane-1-sulfonate.
Molecular Properties
| Compound Name | [2-[(E)-2-(3,5-dichloro-4-hexoxyphenyl)ethenyl]-4-methyl-6-oxo-1-pyridinyl] propane-1-sulfonate |
| PubChem CID | 19100003 |
| Molecular Formula | C23H29Cl2NO5S |
| Molecular Weight | 502.46 g/mol |
| Exact Mass | 501.11 |
| IUPAC Name | [2-[(E)-2-(3,5-dichloro-4-hexoxyphenyl)ethenyl]-4-methyl-6-oxo-1-pyridinyl] propane-1-sulfonate |
| SMILES | CCCCCCOc1c(Cl)cc(/C=C/c2cc(C)cc(=O)n2OS(=O)(=O)CCC)cc1Cl |
| InChI | InChI=1S/C23H29Cl2NO5S/c1-4-6-7-8-11-30-23-20(24)15-18(16-21(23)25)9-10-19-13-17(3)14-22(27)26(19)31-32(28,29)12-5-2/h9-10,13-16H,4-8,11-12H2,1-3H3/b10-9+ |
| InChIKey | XNQPUPADMCFJFC-MDZDMXLPSA-N |
| XLogP | 5.76 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 502.46 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [2-[(E)-2-(3,5-dichloro-4-hexoxyphenyl)ethenyl]-4-methyl-6-oxo-1-pyridinyl] propane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(E)-2-(3,5-dichloro-4-hexoxyphenyl)ethenyl]-4-methyl-6-oxo-1-pyridinyl] propane-1-sulfonate?
The IUPAC name of [2-[(E)-2-(3,5-dichloro-4-hexoxyphenyl)ethenyl]-4-methyl-6-oxo-1-pyridinyl] propane-1-sulfonate (CID 19100003) is [2-[(E)-2-(3,5-dichloro-4-hexoxyphenyl)ethenyl]-4-methyl-6-oxo-1-pyridinyl] propane-1-sulfonate.
What is the SMILES notation for [2-[(E)-2-(3,5-dichloro-4-hexoxyphenyl)ethenyl]-4-methyl-6-oxo-1-pyridinyl] propane-1-sulfonate?
The canonical SMILES for [2-[(E)-2-(3,5-dichloro-4-hexoxyphenyl)ethenyl]-4-methyl-6-oxo-1-pyridinyl] propane-1-sulfonate is CCCCCCOc1c(Cl)cc(/C=C/c2cc(C)cc(=O)n2OS(=O)(=O)CCC)cc1Cl.
What is the InChIKey of [2-[(E)-2-(3,5-dichloro-4-hexoxyphenyl)ethenyl]-4-methyl-6-oxo-1-pyridinyl] propane-1-sulfonate?
The InChIKey is XNQPUPADMCFJFC-MDZDMXLPSA-N. The full InChI is InChI=1S/C23H29Cl2NO5S/c1-4-6-7-8-11-30-23-20(24)15-18(16-21(23)25)9-10-19-13-17(3)14-22(27)26(19)31-32(28,29)12-5-2/h9-10,13-16H,4-8,11-12H2,1-3H3/b10-9+.
What are the key properties of [2-[(E)-2-(3,5-dichloro-4-hexoxyphenyl)ethenyl]-4-methyl-6-oxo-1-pyridinyl] propane-1-sulfonate?
[2-[(E)-2-(3,5-dichloro-4-hexoxyphenyl)ethenyl]-4-methyl-6-oxo-1-pyridinyl] propane-1-sulfonate has a molecular weight of 502.46 g/mol, XLogP of 5.76, 12 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(E)-2-(3,5-dichloro-4-hexoxyphenyl)ethenyl]-4-methyl-6-oxo-1-pyridinyl] propane-1-sulfonate is sourced from PubChem (CID 19100003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).