C16H18N2O4 — CID 145379100
but-2-ene;ethane;pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 145379100) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is but-2-ene;ethane;pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | but-2-ene;ethane;pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 145379100 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | but-2-ene;ethane;pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | CC.CC=CC.O=c1[nH]c(=O)c2cc3c(=O)[nH]c(=O)c3cc12 |
| InChI | InChI=1S/C10H4N2O4.C4H8.C2H6/c13-7-3-1-4-6(10(16)12-8(4)14)2-5(3)9(15)11-7;1-3-4-2;1-2/h1-2H,(H,11,13,15)(H,12,14,16);3-4H,1-2H3;1-2H3 |
| InChIKey | SWMMHZZVSCLHCO-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 99.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|