C23H25ClN2O3 — CID 134238184
tert-butyl N-[1-(8-chloro-1-methyl-4-oxo-2-phenylquinolin-3-yl)ethyl]carbamate (PubChem CID 134238184) has the molecular formula C23H25ClN2O3 and a molecular weight of 412.92 g/mol. Its IUPAC name is tert-butyl N-[1-(8-chloro-1-methyl-4-oxo-2-phenylquinolin-3-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[1-(8-chloro-1-methyl-4-oxo-2-phenylquinolin-3-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 134238184 |
| Molecular Formula | C23H25ClN2O3 |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | tert-butyl N-[1-(8-chloro-1-methyl-4-oxo-2-phenylquinolin-3-yl)ethyl]carbamate |
| SMILES | CC(NC(=O)OC(C)(C)C)c1c(-c2ccccc2)n(C)c2c(Cl)cccc2c1=O |
| InChI | InChI=1S/C23H25ClN2O3/c1-14(25-22(28)29-23(2,3)4)18-19(15-10-7-6-8-11-15)26(5)20-16(21(18)27)12-9-13-17(20)24/h6-14H,1-5H3,(H,25,28) |
| InChIKey | JMIGADFSJUWAAQ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |