C42H20F12N2O2 — CID 134239969
4-[4,5-bis[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]-2-phenylisoindole-1,3-dione (PubChem CID 134239969) has the molecular formula C42H20F12N2O2 and a molecular weight of 812.61 g/mol. Its IUPAC name is 4-[4,5-bis[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]-2-phenylisoindole-1,3-dione.
| Compound Name | 4-[4,5-bis[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]-2-phenylisoindole-1,3-dione |
|---|---|
| PubChem CID | 134239969 |
| Molecular Formula | C42H20F12N2O2 |
| Molecular Weight | 812.61 g/mol |
| Exact Mass | 812.13 |
| IUPAC Name | 4-[4,5-bis[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]-2-phenylisoindole-1,3-dione |
| SMILES | O=C1c2cccc(-n3c4cccc(-c5ccc(C(F)(F)F)cc5C(F)(F)F)c4c4c(-c5ccc(C(F)(F)F)cc5C(F)(F)F)cccc43)c2C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C42H20F12N2O2/c43-39(44,45)21-15-17-24(29(19-21)41(49,50)51)26-9-4-12-31-34(26)35-27(25-18-16-22(40(46,47)48)20-30(25)42(52,53)54)10-5-13-32(35)56(31)33-14-6-11-28-36(33)38(58)55(37(28)57)23-7-2-1-3-8-23/h1-20H |
| InChIKey | GEZMZGRQDZOTIT-UHFFFAOYSA-N |
| XLogP | 12.99 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.61 |
| LogP ≤ 5 | 12.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|