C54H34F6N2O2 — CID 159475322
4-[4-[2,4-bis(trifluoromethyl)phenyl]-5-(2,4-dimethylphenyl)carbazol-9-yl]-2-(2,4-diphenylphenyl)isoindole-1,3-dione (PubChem CID 159475322) has the molecular formula C54H34F6N2O2 and a molecular weight of 856.87 g/mol. Its IUPAC name is 4-[4-[2,4-bis(trifluoromethyl)phenyl]-5-(2,4-dimethylphenyl)carbazol-9-yl]-2-(2,4-diphenylphenyl)isoindole-1,3-dione.
| Compound Name | 4-[4-[2,4-bis(trifluoromethyl)phenyl]-5-(2,4-dimethylphenyl)carbazol-9-yl]-2-(2,4-diphenylphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 159475322 |
| Molecular Formula | C54H34F6N2O2 |
| Molecular Weight | 856.87 g/mol |
| Exact Mass | 856.25 |
| IUPAC Name | 4-[4-[2,4-bis(trifluoromethyl)phenyl]-5-(2,4-dimethylphenyl)carbazol-9-yl]-2-(2,4-diphenylphenyl)isoindole-1,3-dione |
| SMILES | Cc1ccc(-c2cccc3c2c2c(-c4ccc(C(F)(F)F)cc4C(F)(F)F)cccc2n3-c2cccc3c2C(=O)N(c2ccc(-c4ccccc4)cc2-c2ccccc2)C3=O)c(C)c1 |
| InChI | InChI=1S/C54H34F6N2O2/c1-31-22-25-37(32(2)28-31)39-16-9-19-45-48(39)49-40(38-26-24-36(53(55,56)57)30-43(38)54(58,59)60)17-10-20-46(49)61(45)47-21-11-18-41-50(47)52(64)62(51(41)63)44-27-23-35(33-12-5-3-6-13-33)29-42(44)34-14-7-4-8-15-34/h3-30H,1-2H3 |
| InChIKey | IBDKHIGRAXRIHF-UHFFFAOYSA-N |
| XLogP | 14.91 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.87 |
| LogP ≤ 5 | 14.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|