C33H43NO9 — CID 134241613
6-[2-[2-[2-[2-[2-[3-[(E)-hexoxyiminomethyl]phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]naphthalene-1,4-dione (PubChem CID 134241613) has the molecular formula C33H43NO9 and a molecular weight of 597.71 g/mol. Its IUPAC name is 6-[2-[2-[2-[2-[2-[3-[(E)-hexoxyiminomethyl]phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]naphthalene-1,4-dione.
| Compound Name | 6-[2-[2-[2-[2-[2-[3-[(E)-hexoxyiminomethyl]phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 134241613 |
| Molecular Formula | C33H43NO9 |
| Molecular Weight | 597.71 g/mol |
| Exact Mass | 597.29 |
| IUPAC Name | 6-[2-[2-[2-[2-[2-[3-[(E)-hexoxyiminomethyl]phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]naphthalene-1,4-dione |
| SMILES | CCCCCCO/N=C/c1cccc(OCCOCCOCCOCCOCCOc2ccc3c(c2)C(=O)C=CC3=O)c1 |
| InChI | InChI=1S/C33H43NO9/c1-2-3-4-5-13-43-34-26-27-7-6-8-28(24-27)41-22-20-39-18-16-37-14-15-38-17-19-40-21-23-42-29-9-10-30-31(25-29)33(36)12-11-32(30)35/h6-12,24-26H,2-5,13-23H2,1H3/b34-26+ |
| InChIKey | ORUFDEVDMRYSDJ-JJNGWGCYSA-N |
| XLogP | 5.08 |
| TPSA | 111.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.71 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|