C25H16F6I6O9S — CID 134243258
2-[3,5-bis[(2,4,6-triiodophenoxy)carbonyl]cyclohexanecarbonyl]oxy-3,3,3-trifluoro-2-(trifluoromethyl)propane-1-sulfonic acid (PubChem CID 134243258) has the molecular formula C25H16F6I6O9S and a molecular weight of 1367.87 g/mol. Its IUPAC name is 2-[3,5-bis[(2,4,6-triiodophenoxy)carbonyl]cyclohexanecarbonyl]oxy-3,3,3-trifluoro-2-(trifluoromethyl)propane-1-sulfonic acid.
| Compound Name | 2-[3,5-bis[(2,4,6-triiodophenoxy)carbonyl]cyclohexanecarbonyl]oxy-3,3,3-trifluoro-2-(trifluoromethyl)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 134243258 |
| Molecular Formula | C25H16F6I6O9S |
| Molecular Weight | 1367.87 g/mol |
| Exact Mass | 1367.47 |
| IUPAC Name | 2-[3,5-bis[(2,4,6-triiodophenoxy)carbonyl]cyclohexanecarbonyl]oxy-3,3,3-trifluoro-2-(trifluoromethyl)propane-1-sulfonic acid |
| SMILES | O=C(Oc1c(I)cc(I)cc1I)C1CC(C(=O)Oc2c(I)cc(I)cc2I)CC(C(=O)OC(CS(=O)(=O)O)(C(F)(F)F)C(F)(F)F)C1 |
| InChI | InChI=1S/C25H16F6I6O9S/c26-24(27,28)23(25(29,30)31,8-47(41,42)43)46-22(40)11-2-9(20(38)44-18-14(34)4-12(32)5-15(18)35)1-10(3-11)21(39)45-19-16(36)6-13(33)7-17(19)37/h4-7,9-11H,1-3,8H2,(H,41,42,43) |
| InChIKey | AANKLMQBRQZPHK-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1367.87 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|