C13H22O3 — CID 134243324
4-(2-ethyl-2-methylhexyl)-5-methyl-1,3-dioxol-2-one (PubChem CID 134243324) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is 4-(2-ethyl-2-methylhexyl)-5-methyl-1,3-dioxol-2-one.
| Compound Name | 4-(2-ethyl-2-methylhexyl)-5-methyl-1,3-dioxol-2-one |
|---|---|
| PubChem CID | 134243324 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | 4-(2-ethyl-2-methylhexyl)-5-methyl-1,3-dioxol-2-one |
| SMILES | CCCCC(C)(CC)Cc1oc(=O)oc1C |
| InChI | InChI=1S/C13H22O3/c1-5-7-8-13(4,6-2)9-11-10(3)15-12(14)16-11/h5-9H2,1-4H3 |
| InChIKey | AHTQOVUINIHPGO-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 43.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |