C7H10O3S — CID 166842506
4-methyl-5-(3-sulfanylpropyl)-1,3-dioxol-2-one (PubChem CID 166842506) has the molecular formula C7H10O3S and a molecular weight of 174.22 g/mol. Its IUPAC name is 4-methyl-5-(3-sulfanylpropyl)-1,3-dioxol-2-one.
| Compound Name | 4-methyl-5-(3-sulfanylpropyl)-1,3-dioxol-2-one |
|---|---|
| PubChem CID | 166842506 |
| Molecular Formula | C7H10O3S |
| Molecular Weight | 174.22 g/mol |
| Exact Mass | 174.04 |
| IUPAC Name | 4-methyl-5-(3-sulfanylpropyl)-1,3-dioxol-2-one |
| SMILES | Cc1oc(=O)oc1CCCS |
| InChI | InChI=1S/C7H10O3S/c1-5-6(3-2-4-11)10-7(8)9-5/h11H,2-4H2,1H3 |
| InChIKey | PHABNQFIMZLDJQ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 43.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.22 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|