C23H31N5O6 — CID 134243988
(2S,3R)-2-[8-[(2S,3R)-1-amino-3-hydroxy-1-oxobutan-2-yl]-5-benzyl-3,7-dioxo-2,5,8-triazadispiro[3.1.36.24]undecan-2-yl]-3-hydroxybutanamide (PubChem CID 134243988) has the molecular formula C23H31N5O6 and a molecular weight of 473.53 g/mol. Its IUPAC name is (2S,3R)-2-[8-[(2S,3R)-1-amino-3-hydroxy-1-oxobutan-2-yl]-5-benzyl-3,7-dioxo-2,5,8-triazadispiro[3.1.36.24]undecan-2-yl]-3-hydroxybutanamide.
| Compound Name | (2S,3R)-2-[8-[(2S,3R)-1-amino-3-hydroxy-1-oxobutan-2-yl]-5-benzyl-3,7-dioxo-2,5,8-triazadispiro[3.1.36.24]undecan-2-yl]-3-hydroxybutanamide |
|---|---|
| PubChem CID | 134243988 |
| Molecular Formula | C23H31N5O6 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | (2S,3R)-2-[8-[(2S,3R)-1-amino-3-hydroxy-1-oxobutan-2-yl]-5-benzyl-3,7-dioxo-2,5,8-triazadispiro[3.1.36.24]undecan-2-yl]-3-hydroxybutanamide |
| SMILES | C[C@@H](O)[C@@H](C(N)=O)N1CC2(CCC3(CN([C@H](C(N)=O)[C@@H](C)O)C3=O)N2Cc2ccccc2)C1=O |
| InChI | InChI=1S/C23H31N5O6/c1-13(29)16(18(24)31)26-11-22(20(26)33)8-9-23(28(22)10-15-6-4-3-5-7-15)12-27(21(23)34)17(14(2)30)19(25)32/h3-7,13-14,16-17,29-30H,8-12H2,1-2H3,(H2,24,31)(H2,25,32)/t13-,14-,16+,17+,22?,23?/m1/s1 |
| InChIKey | RMNGMGOBGZZTTP-UPFKBKGFSA-N |
| XLogP | -2.09 |
| TPSA | 170.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |