C13H22N2O3 — CID 134244857
(3R)-3-hydroxy-2-(7-methyl-3-oxo-2-azaspiro[3.5]nonan-2-yl)butanamide (PubChem CID 134244857) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is (3R)-3-hydroxy-2-(7-methyl-3-oxo-2-azaspiro[3.5]nonan-2-yl)butanamide.
| Compound Name | (3R)-3-hydroxy-2-(7-methyl-3-oxo-2-azaspiro[3.5]nonan-2-yl)butanamide |
|---|---|
| PubChem CID | 134244857 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | (3R)-3-hydroxy-2-(7-methyl-3-oxo-2-azaspiro[3.5]nonan-2-yl)butanamide |
| SMILES | CC1CCC2(CC1)CN(C(C(N)=O)[C@@H](C)O)C2=O |
| InChI | InChI=1S/C13H22N2O3/c1-8-3-5-13(6-4-8)7-15(12(13)18)10(9(2)16)11(14)17/h8-10,16H,3-7H2,1-2H3,(H2,14,17)/t8?,9-,10?,13?/m1/s1 |
| InChIKey | PLJBJNFAORQQMB-ZMLSKKEWSA-N |
| XLogP | 0.26 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |