C15H23N3O3 — CID 167202368
(2S)-3-methyl-2-[(5S)-1-oxo-7-prop-2-enoyl-2,7-diazaspiro[4.4]nonan-2-yl]butanamide (PubChem CID 167202368) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is (2S)-3-methyl-2-[(5S)-1-oxo-7-prop-2-enoyl-2,7-diazaspiro[4.4]nonan-2-yl]butanamide.
| Compound Name | (2S)-3-methyl-2-[(5S)-1-oxo-7-prop-2-enoyl-2,7-diazaspiro[4.4]nonan-2-yl]butanamide |
|---|---|
| PubChem CID | 167202368 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | (2S)-3-methyl-2-[(5S)-1-oxo-7-prop-2-enoyl-2,7-diazaspiro[4.4]nonan-2-yl]butanamide |
| SMILES | C=CC(=O)N1CC[C@]2(CCN([C@H](C(N)=O)C(C)C)C2=O)C1 |
| InChI | InChI=1S/C15H23N3O3/c1-4-11(19)17-7-5-15(9-17)6-8-18(14(15)21)12(10(2)3)13(16)20/h4,10,12H,1,5-9H2,2-3H3,(H2,16,20)/t12-,15-/m0/s1 |
| InChIKey | VVASTBYNUMKWNZ-WFASDCNBSA-N |
| XLogP | 0.13 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|