3-(2,5-dioxopyrrol-1-yl)azetidine-3-carboxylic acid

C8H8N2O4 — CID 134249524

IUPAC3-(2,5-dioxopyrrol-1-yl)azetidine-3-carboxylic acid
SMILESO=C1C=CC(=O)N1C1(C(=O)O)CNC1
InChIInChI=1S/C8H8N2O4/c11-5-1-2-6(12)10(5)8(7(13)14)3-9-4-8/h1-2,9H,3-4H2,(H,13,14)
InChIKeyIBZQLERXARJQNT-UHFFFAOYSA-N
MW196.16 g/mol
LogP-1.66
Rot. Bonds2

About 3-(2,5-dioxopyrrol-1-yl)azetidine-3-carboxylic acid

3-(2,5-dioxopyrrol-1-yl)azetidine-3-carboxylic acid (PubChem CID 134249524) has the molecular formula C8H8N2O4 and a molecular weight of 196.16 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrol-1-yl)azetidine-3-carboxylic acid.

Molecular Properties

Compound Name3-(2,5-dioxopyrrol-1-yl)azetidine-3-carboxylic acid
PubChem CID134249524
Molecular FormulaC8H8N2O4
Molecular Weight196.16 g/mol
Exact Mass196.05
IUPAC Name3-(2,5-dioxopyrrol-1-yl)azetidine-3-carboxylic acid
SMILESO=C1C=CC(=O)N1C1(C(=O)O)CNC1
InChIInChI=1S/C8H8N2O4/c11-5-1-2-6(12)10(5)8(7(13)14)3-9-4-8/h1-2,9H,3-4H2,(H,13,14)
InChIKeyIBZQLERXARJQNT-UHFFFAOYSA-N
XLogP-1.66
TPSA86.71 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.16
LogP ≤ 5-1.66
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze 3-(2,5-dioxopyrrol-1-yl)azetidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,5-dioxopyrrol-1-yl)azetidine-3-carboxylic acid?
The IUPAC name of 3-(2,5-dioxopyrrol-1-yl)azetidine-3-carboxylic acid (CID 134249524) is 3-(2,5-dioxopyrrol-1-yl)azetidine-3-carboxylic acid.
What is the SMILES notation for 3-(2,5-dioxopyrrol-1-yl)azetidine-3-carboxylic acid?
The canonical SMILES for 3-(2,5-dioxopyrrol-1-yl)azetidine-3-carboxylic acid is O=C1C=CC(=O)N1C1(C(=O)O)CNC1.
What is the InChIKey of 3-(2,5-dioxopyrrol-1-yl)azetidine-3-carboxylic acid?
The InChIKey is IBZQLERXARJQNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O4/c11-5-1-2-6(12)10(5)8(7(13)14)3-9-4-8/h1-2,9H,3-4H2,(H,13,14).
What are the key properties of 3-(2,5-dioxopyrrol-1-yl)azetidine-3-carboxylic acid?
3-(2,5-dioxopyrrol-1-yl)azetidine-3-carboxylic acid has a molecular weight of 196.16 g/mol, XLogP of -1.66, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-dioxopyrrol-1-yl)azetidine-3-carboxylic acid is sourced from PubChem (CID 134249524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).