C18H13F3O — CID 134252756
3,3,3-trifluoro-2-methyl-1-phenanthren-3-ylpropan-1-one (PubChem CID 134252756) has the molecular formula C18H13F3O and a molecular weight of 302.30 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-methyl-1-phenanthren-3-ylpropan-1-one.
| Compound Name | 3,3,3-trifluoro-2-methyl-1-phenanthren-3-ylpropan-1-one |
|---|---|
| PubChem CID | 134252756 |
| Molecular Formula | C18H13F3O |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 3,3,3-trifluoro-2-methyl-1-phenanthren-3-ylpropan-1-one |
| SMILES | CC(C(=O)c1ccc2ccc3ccccc3c2c1)C(F)(F)F |
| InChI | InChI=1S/C18H13F3O/c1-11(18(19,20)21)17(22)14-9-8-13-7-6-12-4-2-3-5-15(12)16(13)10-14/h2-11H,1H3 |
| InChIKey | QQFLSVOFDPLRCW-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|