C26H46FNO12P2S — CID 134253504
2-[4-(7-fluoro-10,13-dimethyl-3,7-diphosphonooxy-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)pentanoylamino]ethanesulfonic acid (PubChem CID 134253504) has the molecular formula C26H46FNO12P2S and a molecular weight of 677.66 g/mol. Its IUPAC name is 2-[4-(7-fluoro-10,13-dimethyl-3,7-diphosphonooxy-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)pentanoylamino]ethanesulfonic acid.
| Compound Name | 2-[4-(7-fluoro-10,13-dimethyl-3,7-diphosphonooxy-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)pentanoylamino]ethanesulfonic acid |
|---|---|
| PubChem CID | 134253504 |
| Molecular Formula | C26H46FNO12P2S |
| Molecular Weight | 677.66 g/mol |
| Exact Mass | 677.22 |
| IUPAC Name | 2-[4-(7-fluoro-10,13-dimethyl-3,7-diphosphonooxy-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)pentanoylamino]ethanesulfonic acid |
| SMILES | CC(CCC(=O)NCCS(=O)(=O)O)C1CCC2C3C(CCC12C)C1(C)CCC(OP(=O)(O)O)CC1CC3(F)OP(=O)(O)O |
| InChI | InChI=1S/C26H46FNO12P2S/c1-16(4-7-22(29)28-12-13-43(36,37)38)19-5-6-20-23-21(9-11-25(19,20)3)24(2)10-8-18(39-41(30,31)32)14-17(24)15-26(23,27)40-42(33,34)35/h16-21,23H,4-15H2,1-3H3,(H,28,29)(H2,30,31,32)(H2,33,34,35)(H,36,37,38) |
| InChIKey | APSJOPGLNKVSKY-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 216.99 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.66 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|