C26H43F2NO4S — CID 134253677
2-[4-(7,7-difluoro-10,13-dimethyl-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)pentanoylamino]ethanesulfonic acid (PubChem CID 134253677) has the molecular formula C26H43F2NO4S and a molecular weight of 503.70 g/mol. Its IUPAC name is 2-[4-(7,7-difluoro-10,13-dimethyl-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)pentanoylamino]ethanesulfonic acid.
| Compound Name | 2-[4-(7,7-difluoro-10,13-dimethyl-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)pentanoylamino]ethanesulfonic acid |
|---|---|
| PubChem CID | 134253677 |
| Molecular Formula | C26H43F2NO4S |
| Molecular Weight | 503.70 g/mol |
| Exact Mass | 503.29 |
| IUPAC Name | 2-[4-(7,7-difluoro-10,13-dimethyl-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)pentanoylamino]ethanesulfonic acid |
| SMILES | CC(CCC(=O)NCCS(=O)(=O)O)C1CCC2C3C(CCC12C)C1(C)CCCCC1CC3(F)F |
| InChI | InChI=1S/C26H43F2NO4S/c1-17(7-10-22(30)29-14-15-34(31,32)33)19-8-9-20-23-21(11-13-25(19,20)3)24(2)12-5-4-6-18(24)16-26(23,27)28/h17-21,23H,4-16H2,1-3H3,(H,29,30)(H,31,32,33) |
| InChIKey | MKTVNPIPJCYNGC-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.70 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|