C26H45NNaO8PS — CID 23714936
sodium 2-[4-[(3R,10S,13R,17R)-10,13-dimethyl-3-phosphonooxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoylamino]ethanesulfonate (PubChem CID 23714936) has the molecular formula C26H45NNaO8PS and a molecular weight of 585.68 g/mol. Its IUPAC name is sodium 2-[4-[(3R,10S,13R,17R)-10,13-dimethyl-3-phosphonooxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoylamino]ethanesulfonate.
| Compound Name | sodium 2-[4-[(3R,10S,13R,17R)-10,13-dimethyl-3-phosphonooxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoylamino]ethanesulfonate |
|---|---|
| PubChem CID | 23714936 |
| Molecular Formula | C26H45NNaO8PS |
| Molecular Weight | 585.68 g/mol |
| Exact Mass | 585.25 |
| IUPAC Name | sodium 2-[4-[(3R,10S,13R,17R)-10,13-dimethyl-3-phosphonooxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoylamino]ethanesulfonate |
| SMILES | CC(CCC(=O)NCCS(=O)(=O)[O-])[C@H]1CCC2C3CCC4C[C@H](OP(=O)(O)O)CC[C@]4(C)C3CC[C@@]21C.[Na+] |
| InChI | InChI=1S/C26H46NO8PS.Na/c1-17(4-9-24(28)27-14-15-37(32,33)34)21-7-8-22-20-6-5-18-16-19(35-36(29,30)31)10-12-25(18,2)23(20)11-13-26(21,22)3;/h17-23H,4-16H2,1-3H3,(H,27,28)(H2,29,30,31)(H,32,33,34);/q;+1/p-1/t17?,18?,19-,20?,21-,22?,23?,25+,26-;/m1./s1 |
| InChIKey | ILJRLQILRWJFRG-GYDLOZKYSA-M |
| XLogP | 1.20 |
| TPSA | 153.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.68 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|