C24H41FO11P2 — CID 134253516
4-(7-fluoro-7-hydroxy-10,13-dimethyl-3,12-diphosphonooxy-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)pentanoic acid (PubChem CID 134253516) has the molecular formula C24H41FO11P2 and a molecular weight of 586.53 g/mol. Its IUPAC name is 4-(7-fluoro-7-hydroxy-10,13-dimethyl-3,12-diphosphonooxy-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)pentanoic acid.
| Compound Name | 4-(7-fluoro-7-hydroxy-10,13-dimethyl-3,12-diphosphonooxy-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)pentanoic acid |
|---|---|
| PubChem CID | 134253516 |
| Molecular Formula | C24H41FO11P2 |
| Molecular Weight | 586.53 g/mol |
| Exact Mass | 586.21 |
| IUPAC Name | 4-(7-fluoro-7-hydroxy-10,13-dimethyl-3,12-diphosphonooxy-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)pentanoic acid |
| SMILES | CC(CCC(=O)O)C1CCC2C3C(CC(OP(=O)(O)O)C12C)C1(C)CCC(OP(=O)(O)O)CC1CC3(O)F |
| InChI | InChI=1S/C24H41FO11P2/c1-13(4-7-20(26)27)16-5-6-17-21-18(11-19(23(16,17)3)36-38(32,33)34)22(2)9-8-15(35-37(29,30)31)10-14(22)12-24(21,25)28/h13-19,21,28H,4-12H2,1-3H3,(H,26,27)(H2,29,30,31)(H2,32,33,34) |
| InChIKey | AXBPVXVEQQMJCN-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 191.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.53 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|