C22H30N2O6S2 — CID 134254647
[(2R)-2-(propan-2-yldisulfanyl)propyl] (6aS)-6-hydroxy-2,3-dimethoxy-8-methylidene-11-oxo-6,6a,7,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate (PubChem CID 134254647) has the molecular formula C22H30N2O6S2 and a molecular weight of 482.62 g/mol. Its IUPAC name is [(2R)-2-(propan-2-yldisulfanyl)propyl] (6aS)-6-hydroxy-2,3-dimethoxy-8-methylidene-11-oxo-6,6a,7,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate.
| Compound Name | [(2R)-2-(propan-2-yldisulfanyl)propyl] (6aS)-6-hydroxy-2,3-dimethoxy-8-methylidene-11-oxo-6,6a,7,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate |
|---|---|
| PubChem CID | 134254647 |
| Molecular Formula | C22H30N2O6S2 |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | [(2R)-2-(propan-2-yldisulfanyl)propyl] (6aS)-6-hydroxy-2,3-dimethoxy-8-methylidene-11-oxo-6,6a,7,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate |
| SMILES | C=C1C[C@H]2C(O)N(C(=O)OC[C@@H](C)SSC(C)C)c3cc(OC)c(OC)cc3C(=O)N2C1 |
| InChI | InChI=1S/C22H30N2O6S2/c1-12(2)31-32-14(4)11-30-22(27)24-16-9-19(29-6)18(28-5)8-15(16)20(25)23-10-13(3)7-17(23)21(24)26/h8-9,12,14,17,21,26H,3,7,10-11H2,1-2,4-6H3/t14-,17+,21?/m1/s1 |
| InChIKey | XLCYMVXDIFJIEF-CFNJBXRESA-N |
| XLogP | 3.93 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|