C23H24N2O6S — CID 142286998
(4-sulfanylphenyl)methyl (6aS)-6-hydroxy-2,3-dimethoxy-8-methylidene-11-oxo-6,6a,7,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate (PubChem CID 142286998) has the molecular formula C23H24N2O6S and a molecular weight of 456.52 g/mol. Its IUPAC name is (4-sulfanylphenyl)methyl (6aS)-6-hydroxy-2,3-dimethoxy-8-methylidene-11-oxo-6,6a,7,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate.
| Compound Name | (4-sulfanylphenyl)methyl (6aS)-6-hydroxy-2,3-dimethoxy-8-methylidene-11-oxo-6,6a,7,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate |
|---|---|
| PubChem CID | 142286998 |
| Molecular Formula | C23H24N2O6S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | (4-sulfanylphenyl)methyl (6aS)-6-hydroxy-2,3-dimethoxy-8-methylidene-11-oxo-6,6a,7,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate |
| SMILES | C=C1C[C@H]2C(O)N(C(=O)OCc3ccc(S)cc3)c3cc(OC)c(OC)cc3C(=O)N2C1 |
| InChI | InChI=1S/C23H24N2O6S/c1-13-8-18-22(27)25(23(28)31-12-14-4-6-15(32)7-5-14)17-10-20(30-3)19(29-2)9-16(17)21(26)24(18)11-13/h4-7,9-10,18,22,27,32H,1,8,11-12H2,2-3H3/t18-,22?/m0/s1 |
| InChIKey | GRIIHDGIMOPOMR-HXBUSHRASA-N |
| XLogP | 3.24 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|