C27H32N2O6S2 — CID 134254834
[4-(tert-butyldisulfanyl)phenyl]methyl (6aS)-6-hydroxy-2,3-dimethoxy-8-methylidene-11-oxo-6,6a,7,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate (PubChem CID 134254834) has the molecular formula C27H32N2O6S2 and a molecular weight of 544.70 g/mol. Its IUPAC name is [4-(tert-butyldisulfanyl)phenyl]methyl (6aS)-6-hydroxy-2,3-dimethoxy-8-methylidene-11-oxo-6,6a,7,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate.
| Compound Name | [4-(tert-butyldisulfanyl)phenyl]methyl (6aS)-6-hydroxy-2,3-dimethoxy-8-methylidene-11-oxo-6,6a,7,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate |
|---|---|
| PubChem CID | 134254834 |
| Molecular Formula | C27H32N2O6S2 |
| Molecular Weight | 544.70 g/mol |
| Exact Mass | 544.17 |
| IUPAC Name | [4-(tert-butyldisulfanyl)phenyl]methyl (6aS)-6-hydroxy-2,3-dimethoxy-8-methylidene-11-oxo-6,6a,7,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate |
| SMILES | C=C1C[C@H]2C(O)N(C(=O)OCc3ccc(SSC(C)(C)C)cc3)c3cc(OC)c(OC)cc3C(=O)N2C1 |
| InChI | InChI=1S/C27H32N2O6S2/c1-16-11-21-25(31)29(20-13-23(34-6)22(33-5)12-19(20)24(30)28(21)14-16)26(32)35-15-17-7-9-18(10-8-17)36-37-27(2,3)4/h7-10,12-13,21,25,31H,1,11,14-15H2,2-6H3/t21-,25?/m0/s1 |
| InChIKey | PGKWMPLSVAWUHE-BWDMCYIDSA-N |
| XLogP | 5.49 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.70 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|