About (Z)-but-2-enedioic acid;(Z)-2-ethylbut-2-enedioic acid
(Z)-but-2-enedioic acid;(Z)-2-ethylbut-2-enedioic acid (PubChem CID 134261232) has the molecular formula C10H12O8
and a molecular weight of 260.20 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;(Z)-2-ethylbut-2-enedioic acid.
Molecular Properties
| Compound Name | (Z)-but-2-enedioic acid;(Z)-2-ethylbut-2-enedioic acid |
| PubChem CID | 134261232 |
| Molecular Formula | C10H12O8 |
| Molecular Weight | 260.20 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | (Z)-but-2-enedioic acid;(Z)-2-ethylbut-2-enedioic acid |
| SMILES | CC/C(=C/C(=O)O)C(=O)O.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C6H8O4.C4H4O4/c1-2-4(6(9)10)3-5(7)8;5-3(6)1-2-4(7)8/h3H,2H2,1H3,(H,7,8)(H,9,10);1-2H,(H,5,6)(H,7,8)/b4-3-;2-1- |
| InChIKey | GXYNDXIWPXHMHP-WQMAPKSTSA-N |
| XLogP | 0.20 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.20 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-but-2-enedioic acid;(Z)-2-ethylbut-2-enedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-but-2-enedioic acid;(Z)-2-ethylbut-2-enedioic acid?
The IUPAC name of (Z)-but-2-enedioic acid;(Z)-2-ethylbut-2-enedioic acid (CID 134261232) is (Z)-but-2-enedioic acid;(Z)-2-ethylbut-2-enedioic acid.
What is the SMILES notation for (Z)-but-2-enedioic acid;(Z)-2-ethylbut-2-enedioic acid?
The canonical SMILES for (Z)-but-2-enedioic acid;(Z)-2-ethylbut-2-enedioic acid is CC/C(=C/C(=O)O)C(=O)O.O=C(O)/C=C\C(=O)O.
What is the InChIKey of (Z)-but-2-enedioic acid;(Z)-2-ethylbut-2-enedioic acid?
The InChIKey is GXYNDXIWPXHMHP-WQMAPKSTSA-N. The full InChI is InChI=1S/C6H8O4.C4H4O4/c1-2-4(6(9)10)3-5(7)8;5-3(6)1-2-4(7)8/h3H,2H2,1H3,(H,7,8)(H,9,10);1-2H,(H,5,6)(H,7,8)/b4-3-;2-1-.
What are the key properties of (Z)-but-2-enedioic acid;(Z)-2-ethylbut-2-enedioic acid?
(Z)-but-2-enedioic acid;(Z)-2-ethylbut-2-enedioic acid has a molecular weight of 260.20 g/mol, XLogP of 0.20, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-but-2-enedioic acid;(Z)-2-ethylbut-2-enedioic acid is sourced from PubChem (CID 134261232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).