(Z)-4-(dihydroxyamino)-2-ethyl-4-oxobut-2-enoic acid

C6H9NO5 — CID 141187786

IUPAC(Z)-4-(dihydroxyamino)-2-ethyl-4-oxobut-2-enoic acid
SMILESCC/C(=C/C(=O)N(O)O)C(=O)O
InChIInChI=1S/C6H9NO5/c1-2-4(6(9)10)3-5(8)7(11)12/h3,11-12H,2H2,1H3,(H,9,10)/b4-3-
InChIKeyXOIJCNLAQGFSAY-ARJAWSKDSA-N
MW175.14 g/mol
LogP0.01
Rot. Bonds3

About (Z)-4-(dihydroxyamino)-2-ethyl-4-oxobut-2-enoic acid

(Z)-4-(dihydroxyamino)-2-ethyl-4-oxobut-2-enoic acid (PubChem CID 141187786) has the molecular formula C6H9NO5 and a molecular weight of 175.14 g/mol. Its IUPAC name is (Z)-4-(dihydroxyamino)-2-ethyl-4-oxobut-2-enoic acid.

Molecular Properties

Compound Name(Z)-4-(dihydroxyamino)-2-ethyl-4-oxobut-2-enoic acid
PubChem CID141187786
Molecular FormulaC6H9NO5
Molecular Weight175.14 g/mol
Exact Mass175.05
IUPAC Name(Z)-4-(dihydroxyamino)-2-ethyl-4-oxobut-2-enoic acid
SMILESCC/C(=C/C(=O)N(O)O)C(=O)O
InChIInChI=1S/C6H9NO5/c1-2-4(6(9)10)3-5(8)7(11)12/h3,11-12H,2H2,1H3,(H,9,10)/b4-3-
InChIKeyXOIJCNLAQGFSAY-ARJAWSKDSA-N
XLogP0.01
TPSA98.07 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500175.14
LogP ≤ 50.01
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze (Z)-4-(dihydroxyamino)-2-ethyl-4-oxobut-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (Z)-4-(dihydroxyamino)-2-ethyl-4-oxobut-2-enoic acid?
The IUPAC name of (Z)-4-(dihydroxyamino)-2-ethyl-4-oxobut-2-enoic acid (CID 141187786) is (Z)-4-(dihydroxyamino)-2-ethyl-4-oxobut-2-enoic acid.
What is the SMILES notation for (Z)-4-(dihydroxyamino)-2-ethyl-4-oxobut-2-enoic acid?
The canonical SMILES for (Z)-4-(dihydroxyamino)-2-ethyl-4-oxobut-2-enoic acid is CC/C(=C/C(=O)N(O)O)C(=O)O.
What is the InChIKey of (Z)-4-(dihydroxyamino)-2-ethyl-4-oxobut-2-enoic acid?
The InChIKey is XOIJCNLAQGFSAY-ARJAWSKDSA-N. The full InChI is InChI=1S/C6H9NO5/c1-2-4(6(9)10)3-5(8)7(11)12/h3,11-12H,2H2,1H3,(H,9,10)/b4-3-.
What are the key properties of (Z)-4-(dihydroxyamino)-2-ethyl-4-oxobut-2-enoic acid?
(Z)-4-(dihydroxyamino)-2-ethyl-4-oxobut-2-enoic acid has a molecular weight of 175.14 g/mol, XLogP of 0.01, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-(dihydroxyamino)-2-ethyl-4-oxobut-2-enoic acid is sourced from PubChem (CID 141187786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).