C11H15F8NO — CID 134263894
1-[1-(2,2,3,3,4,4,5,5-octafluoropentoxy)ethyl]pyrrolidine (PubChem CID 134263894) has the molecular formula C11H15F8NO and a molecular weight of 329.23 g/mol. Its IUPAC name is 1-[1-(2,2,3,3,4,4,5,5-octafluoropentoxy)ethyl]pyrrolidine.
| Compound Name | 1-[1-(2,2,3,3,4,4,5,5-octafluoropentoxy)ethyl]pyrrolidine |
|---|---|
| PubChem CID | 134263894 |
| Molecular Formula | C11H15F8NO |
| Molecular Weight | 329.23 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 1-[1-(2,2,3,3,4,4,5,5-octafluoropentoxy)ethyl]pyrrolidine |
| SMILES | CC(OCC(F)(F)C(F)(F)C(F)(F)C(F)F)N1CCCC1 |
| InChI | InChI=1S/C11H15F8NO/c1-7(20-4-2-3-5-20)21-6-9(14,15)11(18,19)10(16,17)8(12)13/h7-8H,2-6H2,1H3 |
| InChIKey | RRFXAXPNWWEXTM-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.23 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|