C11H6F17NO — CID 130407887
2,2,3,3,4,4,5,5-octafluoro-1-[1,2,2-trifluoro-3-(2,2,3,4,4,4-hexafluorobutoxy)propyl]pyrrolidine (PubChem CID 130407887) has the molecular formula C11H6F17NO and a molecular weight of 491.14 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluoro-1-[1,2,2-trifluoro-3-(2,2,3,4,4,4-hexafluorobutoxy)propyl]pyrrolidine.
| Compound Name | 2,2,3,3,4,4,5,5-octafluoro-1-[1,2,2-trifluoro-3-(2,2,3,4,4,4-hexafluorobutoxy)propyl]pyrrolidine |
|---|---|
| PubChem CID | 130407887 |
| Molecular Formula | C11H6F17NO |
| Molecular Weight | 491.14 g/mol |
| Exact Mass | 491.02 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoro-1-[1,2,2-trifluoro-3-(2,2,3,4,4,4-hexafluorobutoxy)propyl]pyrrolidine |
| SMILES | FC(N1C(F)(F)C(F)(F)C(F)(F)C1(F)F)C(F)(F)COCC(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C11H6F17NO/c12-3(7(18,19)20)5(14,15)1-30-2-6(16,17)4(13)29-10(25,26)8(21,22)9(23,24)11(29,27)28/h3-4H,1-2H2 |
| InChIKey | AXKAFUVISQSQOQ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.14 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|