C9H6F15NO — CID 130418457
1,2,2-trifluoro-3-(2,2,3,4,4,4-hexafluorobutoxy)-N,N-bis(trifluoromethyl)propan-1-amine (PubChem CID 130418457) has the molecular formula C9H6F15NO and a molecular weight of 429.12 g/mol. Its IUPAC name is 1,2,2-trifluoro-3-(2,2,3,4,4,4-hexafluorobutoxy)-N,N-bis(trifluoromethyl)propan-1-amine.
| Compound Name | 1,2,2-trifluoro-3-(2,2,3,4,4,4-hexafluorobutoxy)-N,N-bis(trifluoromethyl)propan-1-amine |
|---|---|
| PubChem CID | 130418457 |
| Molecular Formula | C9H6F15NO |
| Molecular Weight | 429.12 g/mol |
| Exact Mass | 429.02 |
| IUPAC Name | 1,2,2-trifluoro-3-(2,2,3,4,4,4-hexafluorobutoxy)-N,N-bis(trifluoromethyl)propan-1-amine |
| SMILES | FC(N(C(F)(F)F)C(F)(F)F)C(F)(F)COCC(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C9H6F15NO/c10-3(7(16,17)18)5(12,13)1-26-2-6(14,15)4(11)25(8(19,20)21)9(22,23)24/h3-4H,1-2H2 |
| InChIKey | GSARXRIKGKZTET-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.12 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|