C10H12F11NO — CID 161179986
3,3-difluoro-4-(2,2,3,4,4,4-hexafluorobutoxy)-N-methyl-N-(trifluoromethyl)butan-2-amine (PubChem CID 161179986) has the molecular formula C10H12F11NO and a molecular weight of 371.19 g/mol. Its IUPAC name is 3,3-difluoro-4-(2,2,3,4,4,4-hexafluorobutoxy)-N-methyl-N-(trifluoromethyl)butan-2-amine.
| Compound Name | 3,3-difluoro-4-(2,2,3,4,4,4-hexafluorobutoxy)-N-methyl-N-(trifluoromethyl)butan-2-amine |
|---|---|
| PubChem CID | 161179986 |
| Molecular Formula | C10H12F11NO |
| Molecular Weight | 371.19 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | 3,3-difluoro-4-(2,2,3,4,4,4-hexafluorobutoxy)-N-methyl-N-(trifluoromethyl)butan-2-amine |
| SMILES | CC(N(C)C(F)(F)F)C(F)(F)COCC(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C10H12F11NO/c1-5(22(2)10(19,20)21)7(12,13)3-23-4-8(14,15)6(11)9(16,17)18/h5-6H,3-4H2,1-2H3 |
| InChIKey | GOHXHYDKSBKVGP-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.19 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|