C15H19F14NO — CID 145366165
1,1,1,3,3-pentafluoro-4-(2,2,3,4,4,4-hexafluorobutoxy)-N-propyl-N-(4,4,4-trifluorobutyl)butan-2-amine (PubChem CID 145366165) has the molecular formula C15H19F14NO and a molecular weight of 495.30 g/mol. Its IUPAC name is 1,1,1,3,3-pentafluoro-4-(2,2,3,4,4,4-hexafluorobutoxy)-N-propyl-N-(4,4,4-trifluorobutyl)butan-2-amine.
| Compound Name | 1,1,1,3,3-pentafluoro-4-(2,2,3,4,4,4-hexafluorobutoxy)-N-propyl-N-(4,4,4-trifluorobutyl)butan-2-amine |
|---|---|
| PubChem CID | 145366165 |
| Molecular Formula | C15H19F14NO |
| Molecular Weight | 495.30 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | 1,1,1,3,3-pentafluoro-4-(2,2,3,4,4,4-hexafluorobutoxy)-N-propyl-N-(4,4,4-trifluorobutyl)butan-2-amine |
| SMILES | CCCN(CCCC(F)(F)F)C(C(F)(F)F)C(F)(F)COCC(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C15H19F14NO/c1-2-5-30(6-3-4-13(21,22)23)10(15(27,28)29)12(19,20)8-31-7-11(17,18)9(16)14(24,25)26/h9-10H,2-8H2,1H3 |
| InChIKey | QQJYFULGPLSKHF-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.30 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |