C9H9F12NO — CID 137474693
N,1,1,1,3,3-hexafluoro-4-(2,2,3,4,4,4-hexafluorobutoxy)-N-methylbutan-2-amine (PubChem CID 137474693) has the molecular formula C9H9F12NO and a molecular weight of 375.15 g/mol. Its IUPAC name is N,1,1,1,3,3-hexafluoro-4-(2,2,3,4,4,4-hexafluorobutoxy)-N-methylbutan-2-amine.
| Compound Name | N,1,1,1,3,3-hexafluoro-4-(2,2,3,4,4,4-hexafluorobutoxy)-N-methylbutan-2-amine |
|---|---|
| PubChem CID | 137474693 |
| Molecular Formula | C9H9F12NO |
| Molecular Weight | 375.15 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | N,1,1,1,3,3-hexafluoro-4-(2,2,3,4,4,4-hexafluorobutoxy)-N-methylbutan-2-amine |
| SMILES | CN(F)C(C(F)(F)F)C(F)(F)COCC(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C9H9F12NO/c1-22(21)5(9(18,19)20)7(13,14)3-23-2-6(11,12)4(10)8(15,16)17/h4-5H,2-3H2,1H3 |
| InChIKey | XVHFEMPTQLWQCL-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.15 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|