C8H4F15NO — CID 155217315
1,2,2-trifluoro-2-(2,2,3,4,4,4-hexafluorobutoxy)-N,N-bis(trifluoromethyl)ethanamine (PubChem CID 155217315) has the molecular formula C8H4F15NO and a molecular weight of 415.10 g/mol. Its IUPAC name is 1,2,2-trifluoro-2-(2,2,3,4,4,4-hexafluorobutoxy)-N,N-bis(trifluoromethyl)ethanamine.
| Compound Name | 1,2,2-trifluoro-2-(2,2,3,4,4,4-hexafluorobutoxy)-N,N-bis(trifluoromethyl)ethanamine |
|---|---|
| PubChem CID | 155217315 |
| Molecular Formula | C8H4F15NO |
| Molecular Weight | 415.10 g/mol |
| Exact Mass | 415.01 |
| IUPAC Name | 1,2,2-trifluoro-2-(2,2,3,4,4,4-hexafluorobutoxy)-N,N-bis(trifluoromethyl)ethanamine |
| SMILES | FC(C(F)(F)F)C(F)(F)COC(F)(F)C(F)N(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H4F15NO/c9-2(5(13,14)15)4(11,12)1-25-6(16,17)3(10)24(7(18,19)20)8(21,22)23/h2-3H,1H2 |
| InChIKey | QEPKUYIUMHPOND-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.10 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|