C10H15F8NO — CID 134276371
N-ethyl-N-methyl-2-(2,2,3,3,4,4,5,5-octafluoropentoxy)ethanamine (PubChem CID 134276371) has the molecular formula C10H15F8NO and a molecular weight of 317.22 g/mol. Its IUPAC name is N-ethyl-N-methyl-2-(2,2,3,3,4,4,5,5-octafluoropentoxy)ethanamine.
| Compound Name | N-ethyl-N-methyl-2-(2,2,3,3,4,4,5,5-octafluoropentoxy)ethanamine |
|---|---|
| PubChem CID | 134276371 |
| Molecular Formula | C10H15F8NO |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | N-ethyl-N-methyl-2-(2,2,3,3,4,4,5,5-octafluoropentoxy)ethanamine |
| SMILES | CCN(C)CCOCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C10H15F8NO/c1-3-19(2)4-5-20-6-8(13,14)10(17,18)9(15,16)7(11)12/h7H,3-6H2,1-2H3 |
| InChIKey | DSMSNVSEXYLWGW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|