C9H10F12NO+ — CID 20576769
(2-ethoxy-1,1,2,2-tetrafluoroethyl)-fluoro-(1,2,2,3-tetrafluoropropyl)-(1,1,2-trifluoroethyl)azanium (PubChem CID 20576769) has the molecular formula C9H10F12NO+ and a molecular weight of 376.16 g/mol. Its IUPAC name is (2-ethoxy-1,1,2,2-tetrafluoroethyl)-fluoro-(1,2,2,3-tetrafluoropropyl)-(1,1,2-trifluoroethyl)azanium.
| Compound Name | (2-ethoxy-1,1,2,2-tetrafluoroethyl)-fluoro-(1,2,2,3-tetrafluoropropyl)-(1,1,2-trifluoroethyl)azanium |
|---|---|
| PubChem CID | 20576769 |
| Molecular Formula | C9H10F12NO+ |
| Molecular Weight | 376.16 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | (2-ethoxy-1,1,2,2-tetrafluoroethyl)-fluoro-(1,2,2,3-tetrafluoropropyl)-(1,1,2-trifluoroethyl)azanium |
| SMILES | CCOC(F)(F)C(F)(F)[N+](F)(C(F)C(F)(F)CF)C(F)(F)CF |
| InChI | InChI=1S/C9H10F12NO/c1-2-23-9(19,20)8(17,18)22(21,7(15,16)4-11)5(12)6(13,14)3-10/h5H,2-4H2,1H3/q+1 |
| InChIKey | ONKBPPQEWKXFDN-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.16 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|