C9H11F10NO — CID 21353532
N-(2-ethoxy-1,1,2,2-tetrafluoroethyl)-1,1,3-trifluoro-N-(1,1,2-trifluoroethyl)propan-1-amine (PubChem CID 21353532) has the molecular formula C9H11F10NO and a molecular weight of 339.17 g/mol. Its IUPAC name is N-(2-ethoxy-1,1,2,2-tetrafluoroethyl)-1,1,3-trifluoro-N-(1,1,2-trifluoroethyl)propan-1-amine.
| Compound Name | N-(2-ethoxy-1,1,2,2-tetrafluoroethyl)-1,1,3-trifluoro-N-(1,1,2-trifluoroethyl)propan-1-amine |
|---|---|
| PubChem CID | 21353532 |
| Molecular Formula | C9H11F10NO |
| Molecular Weight | 339.17 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | N-(2-ethoxy-1,1,2,2-tetrafluoroethyl)-1,1,3-trifluoro-N-(1,1,2-trifluoroethyl)propan-1-amine |
| SMILES | CCOC(F)(F)C(F)(F)N(C(F)(F)CF)C(F)(F)CCF |
| InChI | InChI=1S/C9H11F10NO/c1-2-21-9(18,19)8(16,17)20(7(14,15)5-11)6(12,13)3-4-10/h2-5H2,1H3 |
| InChIKey | CQATUDXAODVHGR-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.17 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|