C9H11F12NO — CID 91412214
N-(2-ethoxy-1,1,2,2-tetrafluoroethyl)-1,2,2,3-tetrafluoro-N-(1,1,2-trifluoroethyl)propan-1-amine;hydrofluoride (PubChem CID 91412214) has the molecular formula C9H11F12NO and a molecular weight of 377.17 g/mol. Its IUPAC name is N-(2-ethoxy-1,1,2,2-tetrafluoroethyl)-1,2,2,3-tetrafluoro-N-(1,1,2-trifluoroethyl)propan-1-amine;hydrofluoride.
| Compound Name | N-(2-ethoxy-1,1,2,2-tetrafluoroethyl)-1,2,2,3-tetrafluoro-N-(1,1,2-trifluoroethyl)propan-1-amine;hydrofluoride |
|---|---|
| PubChem CID | 91412214 |
| Molecular Formula | C9H11F12NO |
| Molecular Weight | 377.17 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | N-(2-ethoxy-1,1,2,2-tetrafluoroethyl)-1,2,2,3-tetrafluoro-N-(1,1,2-trifluoroethyl)propan-1-amine;hydrofluoride |
| SMILES | CCOC(F)(F)C(F)(F)N(C(F)C(F)(F)CF)C(F)(F)CF.F |
| InChI | InChI=1S/C9H10F11NO.FH/c1-2-22-9(19,20)8(17,18)21(7(15,16)4-11)5(12)6(13,14)3-10;/h5H,2-4H2,1H3;1H |
| InChIKey | RGCAJOHJADITNB-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.17 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|