C27H23FN6O2 — CID 134264705
4-[1-amino-5-(1-but-2-ynoylpyrrolidin-2-yl)pyrrolo[1,2-c]pyrimidin-7-yl]-2-fluoro-N-pyridin-2-ylbenzamide (PubChem CID 134264705) has the molecular formula C27H23FN6O2 and a molecular weight of 482.52 g/mol. Its IUPAC name is 4-[1-amino-5-(1-but-2-ynoylpyrrolidin-2-yl)pyrrolo[1,2-c]pyrimidin-7-yl]-2-fluoro-N-pyridin-2-ylbenzamide.
| Compound Name | 4-[1-amino-5-(1-but-2-ynoylpyrrolidin-2-yl)pyrrolo[1,2-c]pyrimidin-7-yl]-2-fluoro-N-pyridin-2-ylbenzamide |
|---|---|
| PubChem CID | 134264705 |
| Molecular Formula | C27H23FN6O2 |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | 4-[1-amino-5-(1-but-2-ynoylpyrrolidin-2-yl)pyrrolo[1,2-c]pyrimidin-7-yl]-2-fluoro-N-pyridin-2-ylbenzamide |
| SMILES | CC#CC(=O)N1CCCC1c1cc(-c2ccc(C(=O)Nc3ccccn3)c(F)c2)n2c(N)nccc12 |
| InChI | InChI=1S/C27H23FN6O2/c1-2-6-25(35)33-14-5-7-21(33)19-16-23(34-22(19)11-13-31-27(34)29)17-9-10-18(20(28)15-17)26(36)32-24-8-3-4-12-30-24/h3-4,8-13,15-16,21H,5,7,14H2,1H3,(H2,29,31)(H,30,32,36) |
| InChIKey | VYOSHGCTCOVXHA-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 105.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|