C28H22ClN5O2 — CID 134265178
4-[8-(1-but-2-ynoylpyrrolidin-2-yl)quinazolin-6-yl]-3-chloro-N-pyridin-2-ylbenzamide (PubChem CID 134265178) has the molecular formula C28H22ClN5O2 and a molecular weight of 495.97 g/mol. Its IUPAC name is 4-[8-(1-but-2-ynoylpyrrolidin-2-yl)quinazolin-6-yl]-3-chloro-N-pyridin-2-ylbenzamide.
| Compound Name | 4-[8-(1-but-2-ynoylpyrrolidin-2-yl)quinazolin-6-yl]-3-chloro-N-pyridin-2-ylbenzamide |
|---|---|
| PubChem CID | 134265178 |
| Molecular Formula | C28H22ClN5O2 |
| Molecular Weight | 495.97 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | 4-[8-(1-but-2-ynoylpyrrolidin-2-yl)quinazolin-6-yl]-3-chloro-N-pyridin-2-ylbenzamide |
| SMILES | CC#CC(=O)N1CCCC1c1cc(-c2ccc(C(=O)Nc3ccccn3)cc2Cl)cc2cncnc12 |
| InChI | InChI=1S/C28H22ClN5O2/c1-2-6-26(35)34-12-5-7-24(34)22-14-19(13-20-16-30-17-32-27(20)22)21-10-9-18(15-23(21)29)28(36)33-25-8-3-4-11-31-25/h3-4,8-11,13-17,24H,5,7,12H2,1H3,(H,31,33,36) |
| InChIKey | SZXLGUGFVKLLMR-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.97 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|