C28H23N5O2 — CID 170546869
4-[8-(2-prop-2-enoyl-1,2,3,4-tetrahydropyridin-3-yl)quinazolin-6-yl]-N-pyridin-2-ylbenzamide (PubChem CID 170546869) has the molecular formula C28H23N5O2 and a molecular weight of 461.53 g/mol. Its IUPAC name is 4-[8-(2-prop-2-enoyl-1,2,3,4-tetrahydropyridin-3-yl)quinazolin-6-yl]-N-pyridin-2-ylbenzamide.
| Compound Name | 4-[8-(2-prop-2-enoyl-1,2,3,4-tetrahydropyridin-3-yl)quinazolin-6-yl]-N-pyridin-2-ylbenzamide |
|---|---|
| PubChem CID | 170546869 |
| Molecular Formula | C28H23N5O2 |
| Molecular Weight | 461.53 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | 4-[8-(2-prop-2-enoyl-1,2,3,4-tetrahydropyridin-3-yl)quinazolin-6-yl]-N-pyridin-2-ylbenzamide |
| SMILES | C=CC(=O)C1NC=CCC1c1cc(-c2ccc(C(=O)Nc3ccccn3)cc2)cc2cncnc12 |
| InChI | InChI=1S/C28H23N5O2/c1-2-24(34)27-22(6-5-13-31-27)23-15-20(14-21-16-29-17-32-26(21)23)18-8-10-19(11-9-18)28(35)33-25-7-3-4-12-30-25/h2-5,7-17,22,27,31H,1,6H2,(H,30,33,35) |
| InChIKey | CUVVQGBPCCIDMM-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|