C21H13F3N4O4S — CID 134265460
[6-[4-(pyridin-2-ylcarbamoyl)phenyl]quinazolin-8-yl] trifluoromethanesulfonate (PubChem CID 134265460) has the molecular formula C21H13F3N4O4S and a molecular weight of 474.42 g/mol. Its IUPAC name is [6-[4-(pyridin-2-ylcarbamoyl)phenyl]quinazolin-8-yl] trifluoromethanesulfonate.
| Compound Name | [6-[4-(pyridin-2-ylcarbamoyl)phenyl]quinazolin-8-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134265460 |
| Molecular Formula | C21H13F3N4O4S |
| Molecular Weight | 474.42 g/mol |
| Exact Mass | 474.06 |
| IUPAC Name | [6-[4-(pyridin-2-ylcarbamoyl)phenyl]quinazolin-8-yl] trifluoromethanesulfonate |
| SMILES | O=C(Nc1ccccn1)c1ccc(-c2cc(OS(=O)(=O)C(F)(F)F)c3ncncc3c2)cc1 |
| InChI | InChI=1S/C21H13F3N4O4S/c22-21(23,24)33(30,31)32-17-10-15(9-16-11-25-12-27-19(16)17)13-4-6-14(7-5-13)20(29)28-18-3-1-2-8-26-18/h1-12H,(H,26,28,29) |
| InChIKey | IBDFURRVAXHVHU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 111.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.42 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|