C27H24FN5O — CID 175882843
4-[5-(1-but-2-ynylpyrrolidin-2-yl)pyrrolo[1,2-c]pyrimidin-7-yl]-2-fluoro-N-pyridin-2-ylbenzamide (PubChem CID 175882843) has the molecular formula C27H24FN5O and a molecular weight of 453.52 g/mol. Its IUPAC name is 4-[5-(1-but-2-ynylpyrrolidin-2-yl)pyrrolo[1,2-c]pyrimidin-7-yl]-2-fluoro-N-pyridin-2-ylbenzamide.
| Compound Name | 4-[5-(1-but-2-ynylpyrrolidin-2-yl)pyrrolo[1,2-c]pyrimidin-7-yl]-2-fluoro-N-pyridin-2-ylbenzamide |
|---|---|
| PubChem CID | 175882843 |
| Molecular Formula | C27H24FN5O |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | 4-[5-(1-but-2-ynylpyrrolidin-2-yl)pyrrolo[1,2-c]pyrimidin-7-yl]-2-fluoro-N-pyridin-2-ylbenzamide |
| SMILES | CC#CCN1CCCC1c1cc(-c2ccc(C(=O)Nc3ccccn3)c(F)c2)n2cnccc12 |
| InChI | InChI=1S/C27H24FN5O/c1-2-3-14-32-15-6-7-23(32)21-17-25(33-18-29-13-11-24(21)33)19-9-10-20(22(28)16-19)27(34)31-26-8-4-5-12-30-26/h4-5,8-13,16-18,23H,6-7,14-15H2,1H3,(H,30,31,34) |
| InChIKey | GYVXOIPRWYMAFS-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|