C21H16F7N3O2 — CID 134268885
N-[6-(cyclopropanecarbonylamino)-4-[3,5-difluoro-4-(1,1,2,2,2-pentafluoroethyl)phenyl]-2-pyridinyl]cyclopropanecarboxamide (PubChem CID 134268885) has the molecular formula C21H16F7N3O2 and a molecular weight of 475.36 g/mol. Its IUPAC name is N-[6-(cyclopropanecarbonylamino)-4-[3,5-difluoro-4-(1,1,2,2,2-pentafluoroethyl)phenyl]-2-pyridinyl]cyclopropanecarboxamide.
| Compound Name | N-[6-(cyclopropanecarbonylamino)-4-[3,5-difluoro-4-(1,1,2,2,2-pentafluoroethyl)phenyl]-2-pyridinyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 134268885 |
| Molecular Formula | C21H16F7N3O2 |
| Molecular Weight | 475.36 g/mol |
| Exact Mass | 475.11 |
| IUPAC Name | N-[6-(cyclopropanecarbonylamino)-4-[3,5-difluoro-4-(1,1,2,2,2-pentafluoroethyl)phenyl]-2-pyridinyl]cyclopropanecarboxamide |
| SMILES | O=C(Nc1cc(-c2cc(F)c(C(F)(F)C(F)(F)F)c(F)c2)cc(NC(=O)C2CC2)n1)C1CC1 |
| InChI | InChI=1S/C21H16F7N3O2/c22-13-5-11(6-14(23)17(13)20(24,25)21(26,27)28)12-7-15(30-18(32)9-1-2-9)29-16(8-12)31-19(33)10-3-4-10/h5-10H,1-4H2,(H2,29,30,31,32,33) |
| InChIKey | LHNIWLXLGWAHMI-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.36 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|