C21H18F5N3O2 — CID 134268952
N-[6-(cyclopropanecarbonylamino)-4-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]-2-pyridinyl]cyclopropanecarboxamide (PubChem CID 134268952) has the molecular formula C21H18F5N3O2 and a molecular weight of 439.38 g/mol. Its IUPAC name is N-[6-(cyclopropanecarbonylamino)-4-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]-2-pyridinyl]cyclopropanecarboxamide.
| Compound Name | N-[6-(cyclopropanecarbonylamino)-4-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]-2-pyridinyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 134268952 |
| Molecular Formula | C21H18F5N3O2 |
| Molecular Weight | 439.38 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | N-[6-(cyclopropanecarbonylamino)-4-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]-2-pyridinyl]cyclopropanecarboxamide |
| SMILES | O=C(Nc1cc(-c2ccc(C(F)(F)C(F)(F)F)cc2)cc(NC(=O)C2CC2)n1)C1CC1 |
| InChI | InChI=1S/C21H18F5N3O2/c22-20(23,21(24,25)26)15-7-5-11(6-8-15)14-9-16(28-18(30)12-1-2-12)27-17(10-14)29-19(31)13-3-4-13/h5-10,12-13H,1-4H2,(H2,27,28,29,30,31) |
| InChIKey | CMSCWGDGHRDQHY-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.38 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|