C36H33N5 — CID 134269839
5-methyl-N-(3-methylbut-1-en-2-yl)-9-(4-propan-2-yl-3,5,11-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,10,14,16-octaen-15-yl)benzo[h]quinolin-6-amine (PubChem CID 134269839) has the molecular formula C36H33N5 and a molecular weight of 535.70 g/mol. Its IUPAC name is 5-methyl-N-(3-methylbut-1-en-2-yl)-9-(4-propan-2-yl-3,5,11-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,10,14,16-octaen-15-yl)benzo[h]quinolin-6-amine.
| Compound Name | 5-methyl-N-(3-methylbut-1-en-2-yl)-9-(4-propan-2-yl-3,5,11-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,10,14,16-octaen-15-yl)benzo[h]quinolin-6-amine |
|---|---|
| PubChem CID | 134269839 |
| Molecular Formula | C36H33N5 |
| Molecular Weight | 535.70 g/mol |
| Exact Mass | 535.27 |
| IUPAC Name | 5-methyl-N-(3-methylbut-1-en-2-yl)-9-(4-propan-2-yl-3,5,11-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,10,14,16-octaen-15-yl)benzo[h]quinolin-6-amine |
| SMILES | C=C(Nc1c(C)c2cccnc2c2cc(-c3ccc4c(c3)c3ncccc3c3nc(C(C)C)[nH]c43)ccc12)C(C)C |
| InChI | InChI=1S/C36H33N5/c1-19(2)22(6)39-31-21(5)25-9-7-15-37-32(25)29-17-23(11-13-26(29)31)24-12-14-27-30(18-24)33-28(10-8-16-38-33)35-34(27)40-36(41-35)20(3)4/h7-20,39H,6H2,1-5H3,(H,40,41) |
| InChIKey | YTOPXUVUJIGVTG-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.70 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|