C31H23N5 — CID 118569274
4-methyl-15-(2-methyl-4,5-dihydro-1H-naphtho[2,1-e]benzimidazol-7-yl)-3,5,11-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,10,14,16-octaene (PubChem CID 118569274) has the molecular formula C31H23N5 and a molecular weight of 465.56 g/mol. Its IUPAC name is 4-methyl-15-(2-methyl-4,5-dihydro-1H-naphtho[2,1-e]benzimidazol-7-yl)-3,5,11-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,10,14,16-octaene.
| Compound Name | 4-methyl-15-(2-methyl-4,5-dihydro-1H-naphtho[2,1-e]benzimidazol-7-yl)-3,5,11-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,10,14,16-octaene |
|---|---|
| PubChem CID | 118569274 |
| Molecular Formula | C31H23N5 |
| Molecular Weight | 465.56 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | 4-methyl-15-(2-methyl-4,5-dihydro-1H-naphtho[2,1-e]benzimidazol-7-yl)-3,5,11-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,10,14,16-octaene |
| SMILES | Cc1nc2c3c(ccc2[nH]1)-c1ccc(-c2ccc4c(c2)c2ncccc2c2nc(C)[nH]c42)cc1CC3 |
| InChI | InChI=1S/C31H23N5/c1-16-33-27-12-11-22-21-8-5-18(14-20(21)7-10-23(22)29(27)34-16)19-6-9-24-26(15-19)28-25(4-3-13-32-28)31-30(24)35-17(2)36-31/h3-6,8-9,11-15H,7,10H2,1-2H3,(H,33,34)(H,35,36) |
| InChIKey | LQXUKZVGZSYJRH-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.56 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|