C21H13N5 — CID 141245187
2-(1H-indol-5-yl)-1H-imidazo[4,5-f][1,10]phenanthroline (PubChem CID 141245187) has the molecular formula C21H13N5 and a molecular weight of 335.37 g/mol. Its IUPAC name is 2-(1H-indol-5-yl)-1H-imidazo[4,5-f][1,10]phenanthroline.
| Compound Name | 2-(1H-indol-5-yl)-1H-imidazo[4,5-f][1,10]phenanthroline |
|---|---|
| PubChem CID | 141245187 |
| Molecular Formula | C21H13N5 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 2-(1H-indol-5-yl)-1H-imidazo[4,5-f][1,10]phenanthroline |
| SMILES | c1cnc2c(c1)c1nc(-c3ccc4[nH]ccc4c3)[nH]c1c1cccnc12 |
| InChI | InChI=1S/C21H13N5/c1-3-14-17(23-8-1)18-15(4-2-9-24-18)20-19(14)25-21(26-20)13-5-6-16-12(11-13)7-10-22-16/h1-11,22H,(H,25,26) |
| InChIKey | DQFFFABLBLGTSH-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|