C21H14N4O2 — CID 102508548
methyl 4-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)benzoate (PubChem CID 102508548) has the molecular formula C21H14N4O2 and a molecular weight of 354.37 g/mol. Its IUPAC name is methyl 4-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)benzoate.
| Compound Name | methyl 4-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)benzoate |
|---|---|
| PubChem CID | 102508548 |
| Molecular Formula | C21H14N4O2 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | methyl 4-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)benzoate |
| SMILES | COC(=O)c1ccc(-c2nc3c4cccnc4c4ncccc4c3[nH]2)cc1 |
| InChI | InChI=1S/C21H14N4O2/c1-27-21(26)13-8-6-12(7-9-13)20-24-18-14-4-2-10-22-16(14)17-15(19(18)25-20)5-3-11-23-17/h2-11H,1H3,(H,24,25) |
| InChIKey | PZJLNUDWPPFBNU-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|