C18H12N4 — CID 101473917
2-cyclopenta-1,3-dien-1-yl-1H-imidazo[4,5-f][1,10]phenanthroline (PubChem CID 101473917) has the molecular formula C18H12N4 and a molecular weight of 284.32 g/mol. Its IUPAC name is 2-cyclopenta-1,3-dien-1-yl-1H-imidazo[4,5-f][1,10]phenanthroline.
| Compound Name | 2-cyclopenta-1,3-dien-1-yl-1H-imidazo[4,5-f][1,10]phenanthroline |
|---|---|
| PubChem CID | 101473917 |
| Molecular Formula | C18H12N4 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 2-cyclopenta-1,3-dien-1-yl-1H-imidazo[4,5-f][1,10]phenanthroline |
| SMILES | C1=CCC(c2nc3c4cccnc4c4ncccc4c3[nH]2)=C1 |
| InChI | InChI=1S/C18H12N4/c1-2-6-11(5-1)18-21-16-12-7-3-9-19-14(12)15-13(17(16)22-18)8-4-10-20-15/h1-5,7-10H,6H2,(H,21,22) |
| InChIKey | CVBBGHWODCGMBO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|