C19H10F2N4 — CID 102048569
2-(3,5-difluorophenyl)-1H-imidazo[4,5-f][1,10]phenanthroline (PubChem CID 102048569) has the molecular formula C19H10F2N4 and a molecular weight of 332.31 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)-1H-imidazo[4,5-f][1,10]phenanthroline.
| Compound Name | 2-(3,5-difluorophenyl)-1H-imidazo[4,5-f][1,10]phenanthroline |
|---|---|
| PubChem CID | 102048569 |
| Molecular Formula | C19H10F2N4 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 2-(3,5-difluorophenyl)-1H-imidazo[4,5-f][1,10]phenanthroline |
| SMILES | Fc1cc(F)cc(-c2nc3c4cccnc4c4ncccc4c3[nH]2)c1 |
| InChI | InChI=1S/C19H10F2N4/c20-11-7-10(8-12(21)9-11)19-24-17-13-3-1-5-22-15(13)16-14(18(17)25-19)4-2-6-23-16/h1-9H,(H,24,25) |
| InChIKey | IMOZLWDLSCXYLR-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|