C31H22N4O — CID 118569454
13-methyl-5-(2-methyl-3H-phenanthro[9,10-d]imidazol-6-yl)-17-oxa-12,14-diazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2(7),3,5,8,11(15),12-heptaene (PubChem CID 118569454) has the molecular formula C31H22N4O and a molecular weight of 466.54 g/mol. Its IUPAC name is 13-methyl-5-(2-methyl-3H-phenanthro[9,10-d]imidazol-6-yl)-17-oxa-12,14-diazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2(7),3,5,8,11(15),12-heptaene.
| Compound Name | 13-methyl-5-(2-methyl-3H-phenanthro[9,10-d]imidazol-6-yl)-17-oxa-12,14-diazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2(7),3,5,8,11(15),12-heptaene |
|---|---|
| PubChem CID | 118569454 |
| Molecular Formula | C31H22N4O |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | 13-methyl-5-(2-methyl-3H-phenanthro[9,10-d]imidazol-6-yl)-17-oxa-12,14-diazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2(7),3,5,8,11(15),12-heptaene |
| SMILES | Cc1nc2c([nH]1)COc1c-2ccc2cc(-c3ccc4c(c3)c3ccccc3c3nc(C)[nH]c43)ccc12 |
| InChI | InChI=1S/C31H22N4O/c1-16-32-27-15-36-31-21-10-7-18(13-20(21)9-12-25(31)28(27)33-16)19-8-11-24-26(14-19)22-5-3-4-6-23(22)29-30(24)35-17(2)34-29/h3-14H,15H2,1-2H3,(H,32,33)(H,34,35) |
| InChIKey | RHJVJOXQCXQTNF-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|