C28H20N4S — CID 118569383
2-methyl-6-[6-(2-methyl-1H-imidazol-5-yl)-1-benzothiophen-2-yl]-3H-phenanthro[9,10-d]imidazole (PubChem CID 118569383) has the molecular formula C28H20N4S and a molecular weight of 444.56 g/mol. Its IUPAC name is 2-methyl-6-[6-(2-methyl-1H-imidazol-5-yl)-1-benzothiophen-2-yl]-3H-phenanthro[9,10-d]imidazole.
| Compound Name | 2-methyl-6-[6-(2-methyl-1H-imidazol-5-yl)-1-benzothiophen-2-yl]-3H-phenanthro[9,10-d]imidazole |
|---|---|
| PubChem CID | 118569383 |
| Molecular Formula | C28H20N4S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | 2-methyl-6-[6-(2-methyl-1H-imidazol-5-yl)-1-benzothiophen-2-yl]-3H-phenanthro[9,10-d]imidazole |
| SMILES | Cc1ncc(-c2ccc3cc(-c4ccc5c(c4)c4ccccc4c4nc(C)[nH]c54)sc3c2)[nH]1 |
| InChI | InChI=1S/C28H20N4S/c1-15-29-14-24(30-15)17-7-8-19-13-26(33-25(19)12-17)18-9-10-22-23(11-18)20-5-3-4-6-21(20)27-28(22)32-16(2)31-27/h3-14H,1-2H3,(H,29,30)(H,31,32) |
| InChIKey | LXLHTGBFIZFOGD-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|